C7H14N2S — CID 21475745
3-butyl-1,3-thiazolidin-2-imine (PubChem CID 21475745) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 3-butyl-1,3-thiazolidin-2-imine.
| Compound Name | 3-butyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 21475745 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-butyl-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCCN1CCCC |
| InChI | InChI=1S/C7H14N2S/c1-2-3-4-9-5-6-10-7(9)8/h8H,2-6H2,1H3/b8-7- |
| InChIKey | DASPJCWFJYSBGG-FPLPWBNLSA-N |
| XLogP | 1.77 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|