C25H34N4O4 — CID 21476598
3-butan-2-yl-1-(4-carbamimidoylphenyl)-5-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 21476598) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-butan-2-yl-1-(4-carbamimidoylphenyl)-5-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-butan-2-yl-1-(4-carbamimidoylphenyl)-5-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 21476598 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 3-butan-2-yl-1-(4-carbamimidoylphenyl)-5-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2NC(C(=O)O)(C(C)CC)C3C(=O)N(CC4CCCCC4)C(=O)C23)cc1 |
| InChI | InChI=1S/C25H34N4O4/c1-3-14(2)25(24(32)33)19-18(20(28-25)16-9-11-17(12-10-16)21(26)27)22(30)29(23(19)31)13-15-7-5-4-6-8-15/h9-12,14-15,18-20,28H,3-8,13H2,1-2H3,(H3,26,27)(H,32,33) |
| InChIKey | QHJMCLPTMPGVCE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|