C15H13Cl2N3O3 — CID 21479435
methyl 2-(2,6-dichlorophenyl)-2-(2-nitroanilino)ethanimidate (PubChem CID 21479435) has the molecular formula C15H13Cl2N3O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is methyl 2-(2,6-dichlorophenyl)-2-(2-nitroanilino)ethanimidate.
| Compound Name | methyl 2-(2,6-dichlorophenyl)-2-(2-nitroanilino)ethanimidate |
|---|---|
| PubChem CID | 21479435 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | methyl 2-(2,6-dichlorophenyl)-2-(2-nitroanilino)ethanimidate |
| SMILES | [H]/N=C(\OC)C(Nc1ccccc1[N+](=O)[O-])c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-23-15(18)14(13-9(16)5-4-6-10(13)17)19-11-7-2-3-8-12(11)20(21)22/h2-8,14,18-19H,1H3/b18-15- |
| InChIKey | YRLMNTJGPKDMDL-SDXDJHTJSA-N |
| XLogP | 4.68 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|