C18H19ClN4O3S — CID 21481895
[3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate (PubChem CID 21481895) has the molecular formula C18H19ClN4O3S and a molecular weight of 406.90 g/mol. Its IUPAC name is [3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate.
| Compound Name | [3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 21481895 |
| Molecular Formula | C18H19ClN4O3S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate |
| SMILES | CN1CCC(OC(=O)c2cccc(CCl)c2)N(c2nnc(C3CC3)s2)C1=O |
| InChI | InChI=1S/C18H19ClN4O3S/c1-22-8-7-14(26-16(24)13-4-2-3-11(9-13)10-19)23(18(22)25)17-21-20-15(27-17)12-5-6-12/h2-4,9,12,14H,5-8,10H2,1H3 |
| InChIKey | GYROKPVSLGVXSY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|