About dizinc;oxalate;sulfate
dizinc;oxalate;sulfate (PubChem CID 21482692) has the molecular formula C2O8SZn2
and a molecular weight of 314.86 g/mol. Its IUPAC name is dizinc;oxalate;sulfate.
Molecular Properties
| Compound Name | dizinc;oxalate;sulfate |
| PubChem CID | 21482692 |
| Molecular Formula | C2O8SZn2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 311.79 |
| IUPAC Name | dizinc;oxalate;sulfate |
| SMILES | O=C([O-])C(=O)[O-].O=S(=O)([O-])[O-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C2H2O4.H2O4S.2Zn/c3-1(4)2(5)6;1-5(2,3)4;;/h(H,3,4)(H,5,6);(H2,1,2,3,4);;/q;;2*+2/p-4 |
| InChIKey | IXZKEQDTSVUGCV-UHFFFAOYSA-J |
| XLogP | -4.86 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dizinc;oxalate;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dizinc;oxalate;sulfate?
The IUPAC name of dizinc;oxalate;sulfate (CID 21482692) is dizinc;oxalate;sulfate.
What is the SMILES notation for dizinc;oxalate;sulfate?
The canonical SMILES for dizinc;oxalate;sulfate is O=C([O-])C(=O)[O-].O=S(=O)([O-])[O-].[Zn+2].[Zn+2].
What is the InChIKey of dizinc;oxalate;sulfate?
The InChIKey is IXZKEQDTSVUGCV-UHFFFAOYSA-J. The full InChI is InChI=1S/C2H2O4.H2O4S.2Zn/c3-1(4)2(5)6;1-5(2,3)4;;/h(H,3,4)(H,5,6);(H2,1,2,3,4);;/q;;2*+2/p-4.
What are the key properties of dizinc;oxalate;sulfate?
dizinc;oxalate;sulfate has a molecular weight of 314.86 g/mol, XLogP of -4.86, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dizinc;oxalate;sulfate is sourced from PubChem (CID 21482692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).