C21H30N2O7S — CID 21484500
N-[5-[3-(3,4-dimethoxy-N-propan-2-ylanilino)-2-hydroxypropoxy]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 21484500) has the molecular formula C21H30N2O7S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[5-[3-(3,4-dimethoxy-N-propan-2-ylanilino)-2-hydroxypropoxy]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[3-(3,4-dimethoxy-N-propan-2-ylanilino)-2-hydroxypropoxy]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 21484500 |
| Molecular Formula | C21H30N2O7S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[5-[3-(3,4-dimethoxy-N-propan-2-ylanilino)-2-hydroxypropoxy]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(N(CC(O)COc2ccc(O)c(NS(C)(=O)=O)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C21H30N2O7S/c1-14(2)23(15-6-9-20(28-3)21(10-15)29-4)12-16(24)13-30-17-7-8-19(25)18(11-17)22-31(5,26)27/h6-11,14,16,22,24-25H,12-13H2,1-5H3 |
| InChIKey | QMNDERHIRBWIHP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|