C4H7N3S — CID 21492708
3,5-dimethyl-4-sulfanyl-1,2,4-triazole (PubChem CID 21492708) has the molecular formula C4H7N3S and a molecular weight of 129.19 g/mol. Its IUPAC name is 3,5-dimethyl-4-sulfanyl-1,2,4-triazole.
| Compound Name | 3,5-dimethyl-4-sulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 21492708 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 3,5-dimethyl-4-sulfanyl-1,2,4-triazole |
| SMILES | Cc1nnc(C)n1S |
| InChI | InChI=1S/C4H7N3S/c1-3-5-6-4(2)7(3)8/h8H,1-2H3 |
| InChIKey | RTPRLCIBHBKBDF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|