C17H19N3O2 — CID 21496072
6-butyl-5-methyl-7-phenyl-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 21496072) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 6-butyl-5-methyl-7-phenyl-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-butyl-5-methyl-7-phenyl-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21496072 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 6-butyl-5-methyl-7-phenyl-1H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(-c2ccccc2)c2[nH]c(=O)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H19N3O2/c1-3-4-10-20-11(2)13-14(18-17(22)19-16(13)21)15(20)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | OEBGYTMTKLIDRM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |