C19H23N3O5S2 — CID 21497835
3-(cyclopropylmethylamino)-5-sulfamoyl-4-sulfanylbenzoic acid;N-phenylacetamide (PubChem CID 21497835) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-(cyclopropylmethylamino)-5-sulfamoyl-4-sulfanylbenzoic acid;N-phenylacetamide.
| Compound Name | 3-(cyclopropylmethylamino)-5-sulfamoyl-4-sulfanylbenzoic acid;N-phenylacetamide |
|---|---|
| PubChem CID | 21497835 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-(cyclopropylmethylamino)-5-sulfamoyl-4-sulfanylbenzoic acid;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.NS(=O)(=O)c1cc(C(=O)O)cc(NCC2CC2)c1S |
| InChI | InChI=1S/C11H14N2O4S2.C8H9NO/c12-19(16,17)9-4-7(11(14)15)3-8(10(9)18)13-5-6-1-2-6;1-7(10)9-8-5-3-2-4-6-8/h3-4,6,13,18H,1-2,5H2,(H,14,15)(H2,12,16,17);2-6H,1H3,(H,9,10) |
| InChIKey | IBJBZFCLCNFUAQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|