C22H28N2O4S — CID 143663757
3-(amino-methylidene-oxo-λ6-sulfanyl)-5-(butylamino)-4-[2-(cyclopropylmethyl)phenoxy]benzoic acid (PubChem CID 143663757) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 3-(amino-methylidene-oxo-λ6-sulfanyl)-5-(butylamino)-4-[2-(cyclopropylmethyl)phenoxy]benzoic acid.
| Compound Name | 3-(amino-methylidene-oxo-λ6-sulfanyl)-5-(butylamino)-4-[2-(cyclopropylmethyl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 143663757 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3-(amino-methylidene-oxo-λ6-sulfanyl)-5-(butylamino)-4-[2-(cyclopropylmethyl)phenoxy]benzoic acid |
| SMILES | C=S(N)(=O)c1cc(C(=O)O)cc(NCCCC)c1Oc1ccccc1CC1CC1 |
| InChI | InChI=1S/C22H28N2O4S/c1-3-4-11-24-18-13-17(22(25)26)14-20(29(2,23)27)21(18)28-19-8-6-5-7-16(19)12-15-9-10-15/h5-8,13-15,24H,2-4,9-12H2,1H3,(H2,23,27)(H,25,26) |
| InChIKey | FTXCHRKFDXDELM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|