C36H42ClN3O5S — CID 67699196
3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid;N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propan-1-amine;hydrochloride (PubChem CID 67699196) has the molecular formula C36H42ClN3O5S and a molecular weight of 664.27 g/mol. Its IUPAC name is 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid;N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propan-1-amine;hydrochloride.
| Compound Name | 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid;N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67699196 |
| Molecular Formula | C36H42ClN3O5S |
| Molecular Weight | 664.27 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid;N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propan-1-amine;hydrochloride |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1.CNCCCC1c2ccccc2C=Cc2ccccc21.Cl |
| InChI | InChI=1S/C19H21N.C17H20N2O5S.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13;/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3;4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23);1H |
| InChIKey | MYCFNKWMUHXYEP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.27 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|