About 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea
1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 2160830) has the molecular formula C13H13Cl2F3N2O3
and a molecular weight of 373.16 g/mol. Its IUPAC name is 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| PubChem CID | 2160830 |
| Molecular Formula | C13H13Cl2F3N2O3 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | CCCCNC(=O)NC1(C(F)(F)F)Oc2cc(Cl)c(Cl)cc2O1 |
| InChI | InChI=1S/C13H13Cl2F3N2O3/c1-2-3-4-19-11(21)20-13(12(16,17)18)22-9-5-7(14)8(15)6-10(9)23-13/h5-6H,2-4H2,1H3,(H2,19,20,21) |
| InChIKey | SYJPVSACANJNFS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
The IUPAC name of 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (CID 2160830) is 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
What is the SMILES notation for 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
The canonical SMILES for 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea is CCCCNC(=O)NC1(C(F)(F)F)Oc2cc(Cl)c(Cl)cc2O1.
What is the InChIKey of 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
The InChIKey is SYJPVSACANJNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2F3N2O3/c1-2-3-4-19-11(21)20-13(12(16,17)18)22-9-5-7(14)8(15)6-10(9)23-13/h5-6H,2-4H2,1H3,(H2,19,20,21).
What are the key properties of 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea has a molecular weight of 373.16 g/mol, XLogP of 4.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea is sourced from PubChem (CID 2160830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).