C13H13Cl2F3N2O3 — CID 2160830
1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 2160830) has the molecular formula C13H13Cl2F3N2O3 and a molecular weight of 373.16 g/mol. Its IUPAC name is 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
| Compound Name | 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
|---|---|
| PubChem CID | 2160830 |
| Molecular Formula | C13H13Cl2F3N2O3 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 1-butyl-3-[5,6-dichloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | CCCCNC(=O)NC1(C(F)(F)F)Oc2cc(Cl)c(Cl)cc2O1 |
| InChI | InChI=1S/C13H13Cl2F3N2O3/c1-2-3-4-19-11(21)20-13(12(16,17)18)22-9-5-7(14)8(15)6-10(9)23-13/h5-6H,2-4H2,1H3,(H2,19,20,21) |
| InChIKey | SYJPVSACANJNFS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|