C13H14ClF3N2O3 — CID 2160739
1-butyl-3-[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 2160739) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is 1-butyl-3-[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
| Compound Name | 1-butyl-3-[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
|---|---|
| PubChem CID | 2160739 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-butyl-3-[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | CCCCNC(=O)N[C@@]1(C(F)(F)F)Oc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C13H14ClF3N2O3/c1-2-3-6-18-11(20)19-13(12(15,16)17)21-9-5-4-8(14)7-10(9)22-13/h4-5,7H,2-3,6H2,1H3,(H2,18,19,20)/t13-/m0/s1 |
| InChIKey | PZDMOXAQBUEUDC-ZDUSSCGKSA-N |
| XLogP | 3.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|