C12H12ClF3N2O4 — CID 3242697
1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(2-methoxyethyl)urea (PubChem CID 3242697) has the molecular formula C12H12ClF3N2O4 and a molecular weight of 340.69 g/mol. Its IUPAC name is 1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 3242697 |
| Molecular Formula | C12H12ClF3N2O4 |
| Molecular Weight | 340.69 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NC1(C(F)(F)F)Oc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C12H12ClF3N2O4/c1-20-5-4-17-10(19)18-12(11(14,15)16)21-8-3-2-7(13)6-9(8)22-12/h2-3,6H,4-5H2,1H3,(H2,17,18,19) |
| InChIKey | JSCIXFOQZQNPTM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|