C20H18ClF3N2O5 — CID 2160701
butyl 4-[[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]carbamoylamino]benzoate (PubChem CID 2160701) has the molecular formula C20H18ClF3N2O5 and a molecular weight of 458.82 g/mol. Its IUPAC name is butyl 4-[[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]carbamoylamino]benzoate.
| Compound Name | butyl 4-[[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 2160701 |
| Molecular Formula | C20H18ClF3N2O5 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | butyl 4-[[(2S)-5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)N[C@@]2(C(F)(F)F)Oc3ccc(Cl)cc3O2)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O5/c1-2-3-10-29-17(27)12-4-7-14(8-5-12)25-18(28)26-20(19(22,23)24)30-15-9-6-13(21)11-16(15)31-20/h4-9,11H,2-3,10H2,1H3,(H2,25,26,28)/t20-/m0/s1 |
| InChIKey | QIAIPBFUMBGMIV-FQEVSTJZSA-N |
| XLogP | 5.11 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|