C22H13ClN2O4S2 — CID 2162471
[2-[(Z)-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 2162471) has the molecular formula C22H13ClN2O4S2 and a molecular weight of 468.94 g/mol. Its IUPAC name is [2-[(Z)-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-[(Z)-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 2162471 |
| Molecular Formula | C22H13ClN2O4S2 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | [2-[(Z)-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=c1/c(=C/c2ccccc2OS(=O)(=O)c2ccc(Cl)cc2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C22H13ClN2O4S2/c23-15-9-11-16(12-10-15)31(27,28)29-19-8-4-1-5-14(19)13-20-21(26)25-18-7-3-2-6-17(18)24-22(25)30-20/h1-13H/b20-13- |
| InChIKey | LISKHTFMSUVQRS-MOSHPQCFSA-N |
| XLogP | 3.88 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|