C27H18N2O4S2 — CID 3335324
[1-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]naphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 3335324) has the molecular formula C27H18N2O4S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is [1-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]naphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]naphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3335324 |
| Molecular Formula | C27H18N2O4S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [1-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]naphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2C=c2sc3nc4ccccc4n3c2=O)cc1 |
| InChI | InChI=1S/C27H18N2O4S2/c1-17-10-13-19(14-11-17)35(31,32)33-24-15-12-18-6-2-3-7-20(18)21(24)16-25-26(30)29-23-9-5-4-8-22(23)28-27(29)34-25/h2-16H,1H3 |
| InChIKey | YAFOHBYSTNNCKQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|