C15H8Br2F3N3O5 — CID 2169123
N-[2,4-dibromo-5-(trifluoromethyl)phenyl]-4-methyl-3,5-dinitrobenzamide (PubChem CID 2169123) has the molecular formula C15H8Br2F3N3O5 and a molecular weight of 527.05 g/mol. Its IUPAC name is N-[2,4-dibromo-5-(trifluoromethyl)phenyl]-4-methyl-3,5-dinitrobenzamide.
| Compound Name | N-[2,4-dibromo-5-(trifluoromethyl)phenyl]-4-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 2169123 |
| Molecular Formula | C15H8Br2F3N3O5 |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 524.88 |
| IUPAC Name | N-[2,4-dibromo-5-(trifluoromethyl)phenyl]-4-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)Nc2cc(C(F)(F)F)c(Br)cc2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H8Br2F3N3O5/c1-6-12(22(25)26)2-7(3-13(6)23(27)28)14(24)21-11-4-8(15(18,19)20)9(16)5-10(11)17/h2-5H,1H3,(H,21,24) |
| InChIKey | SDZWAUAAAOENKG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|