C20H15ClN2O3S — CID 2174700
4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 2-chlorobenzoate (PubChem CID 2174700) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is 4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 2-chlorobenzoate.
| Compound Name | 4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 2-chlorobenzoate |
|---|---|
| PubChem CID | 2174700 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 2-chlorobenzoate |
| SMILES | Cc1ccc(-c2nnc(SCC#CCOC(=O)c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C20H15ClN2O3S/c1-14-8-10-15(11-9-14)18-22-23-20(26-18)27-13-5-4-12-25-19(24)16-6-2-3-7-17(16)21/h2-3,6-11H,12-13H2,1H3 |
| InChIKey | LKSJRTRWOHGYCA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|