C19H12Cl2N2O5S — CID 3907869
4-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 3,4-dihydroxybenzoate (PubChem CID 3907869) has the molecular formula C19H12Cl2N2O5S and a molecular weight of 451.29 g/mol. Its IUPAC name is 4-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 3,4-dihydroxybenzoate.
| Compound Name | 4-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 3907869 |
| Molecular Formula | C19H12Cl2N2O5S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 4-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 3,4-dihydroxybenzoate |
| SMILES | O=C(OCC#CCSc1nnc(-c2ccc(Cl)cc2Cl)o1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H12Cl2N2O5S/c20-12-4-5-13(14(21)10-12)17-22-23-19(28-17)29-8-2-1-7-27-18(26)11-3-6-15(24)16(25)9-11/h3-6,9-10,24-25H,7-8H2 |
| InChIKey | LXAWHIJWKALDEN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|