C19H12FN3O5S — CID 3412506
4-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 4-nitrobenzoate (PubChem CID 3412506) has the molecular formula C19H12FN3O5S and a molecular weight of 413.39 g/mol. Its IUPAC name is 4-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 4-nitrobenzoate.
| Compound Name | 4-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 3412506 |
| Molecular Formula | C19H12FN3O5S |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 4-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 4-nitrobenzoate |
| SMILES | O=C(OCC#CCSc1nnc(-c2cccc(F)c2)o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12FN3O5S/c20-15-5-3-4-14(12-15)17-21-22-19(28-17)29-11-2-1-10-27-18(24)13-6-8-16(9-7-13)23(25)26/h3-9,12H,10-11H2 |
| InChIKey | XSUGLJMVPQIWKX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|