C25H17N5O7S — CID 73350895
2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 73350895) has the molecular formula C25H17N5O7S and a molecular weight of 531.51 g/mol. Its IUPAC name is 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 73350895 |
| Molecular Formula | C25H17N5O7S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1ccc(C(=O)/C=C\c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H17N5O7S/c31-22(13-6-16-4-11-20(12-5-16)29(33)34)17-7-9-19(10-8-17)26-23(32)15-38-25-28-27-24(37-25)18-2-1-3-21(14-18)30(35)36/h1-14H,15H2,(H,26,32)/b13-6- |
| InChIKey | CUFLNSLBJNKYRO-MLPAPPSSSA-N |
| XLogP | 5.18 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|