C21H13BrN2O4S — CID 2174975
4-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 1-benzofuran-2-carboxylate (PubChem CID 2174975) has the molecular formula C21H13BrN2O4S and a molecular weight of 469.32 g/mol. Its IUPAC name is 4-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 1-benzofuran-2-carboxylate.
| Compound Name | 4-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2174975 |
| Molecular Formula | C21H13BrN2O4S |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | 4-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-ynyl 1-benzofuran-2-carboxylate |
| SMILES | O=C(OCC#CCSc1nnc(-c2ccc(Br)cc2)o1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H13BrN2O4S/c22-16-9-7-14(8-10-16)19-23-24-21(28-19)29-12-4-3-11-26-20(25)18-13-15-5-1-2-6-17(15)27-18/h1-2,5-10,13H,11-12H2 |
| InChIKey | YWLZJTNZMKYUIE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|