C18H12NO4- — CID 2186539
(E)-3-(furan-2-yl)-2-(naphthalene-1-carbonylamino)prop-2-enoate (PubChem CID 2186539) has the molecular formula C18H12NO4- and a molecular weight of 306.30 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-2-(naphthalene-1-carbonylamino)prop-2-enoate.
| Compound Name | (E)-3-(furan-2-yl)-2-(naphthalene-1-carbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 2186539 |
| Molecular Formula | C18H12NO4- |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (E)-3-(furan-2-yl)-2-(naphthalene-1-carbonylamino)prop-2-enoate |
| SMILES | O=C([O-])/C(=C\c1ccco1)NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H13NO4/c20-17(15-9-3-6-12-5-1-2-8-14(12)15)19-16(18(21)22)11-13-7-4-10-23-13/h1-11H,(H,19,20)(H,21,22)/p-1/b16-11+ |
| InChIKey | PLGYDNAYLBRGQF-LFIBNONCSA-M |
| XLogP | 1.95 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|