C13H9ClN2O5S2 — CID 2191235
ethyl [(4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate (PubChem CID 2191235) has the molecular formula C13H9ClN2O5S2 and a molecular weight of 372.81 g/mol. Its IUPAC name is ethyl [(4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate.
| Compound Name | ethyl [(4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate |
|---|---|
| PubChem CID | 2191235 |
| Molecular Formula | C13H9ClN2O5S2 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | ethyl [(4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate |
| SMILES | CCOC(=O)SC1=N/C(=C/c2ccc(Cl)c([N+](=O)[O-])c2)C(=O)S1 |
| InChI | InChI=1S/C13H9ClN2O5S2/c1-2-21-13(18)23-12-15-9(11(17)22-12)5-7-3-4-8(14)10(6-7)16(19)20/h3-6H,2H2,1H3/b9-5+ |
| InChIKey | FSXSGIDLMBYJKT-WEVVVXLNSA-N |
| XLogP | 4.11 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|