C15H8O — CID 21963
tetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-15-one (PubChem CID 21963) has the molecular formula C15H8O and a molecular weight of 204.23 g/mol. Its IUPAC name is tetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-15-one.
| Compound Name | tetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-15-one |
|---|---|
| PubChem CID | 21963 |
| Molecular Formula | C15H8O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | tetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-15-one |
| SMILES | O=c1c2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C15H8O/c16-15-11-5-1-3-9-7-8-10-4-2-6-12(15)14(10)13(9)11/h1-8H |
| InChIKey | IFCBMPOMNSORDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|