C30H45NO3S2 — CID 22033091
4-[9-[3-(dimethylamino)propylsulfinyl]nonyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-7-ol (PubChem CID 22033091) has the molecular formula C30H45NO3S2 and a molecular weight of 531.83 g/mol. Its IUPAC name is 4-[9-[3-(dimethylamino)propylsulfinyl]nonyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-7-ol.
| Compound Name | 4-[9-[3-(dimethylamino)propylsulfinyl]nonyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 22033091 |
| Molecular Formula | C30H45NO3S2 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 4-[9-[3-(dimethylamino)propylsulfinyl]nonyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-7-ol |
| SMILES | CN(C)CCCS(=O)CCCCCCCCCC1c2ccc(O)cc2SCC1(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H45NO3S2/c1-30(24-13-15-25(32)16-14-24)23-35-29-22-26(33)17-18-27(29)28(30)12-9-7-5-4-6-8-10-20-36(34)21-11-19-31(2)3/h13-18,22,28,32-33H,4-12,19-21,23H2,1-3H3 |
| InChIKey | PZLCKEGTVZGZLO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|