C30H40F5NO4S — CID 22033278
3-(4-hydroxyphenyl)-3-methyl-4-[3-[methyl-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentyl]amino]propyl]-2,4-dihydrochromen-7-ol (PubChem CID 22033278) has the molecular formula C30H40F5NO4S and a molecular weight of 605.71 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[3-[methyl-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentyl]amino]propyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[methyl-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentyl]amino]propyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033278 |
| Molecular Formula | C30H40F5NO4S |
| Molecular Weight | 605.71 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[methyl-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentyl]amino]propyl]-2,4-dihydrochromen-7-ol |
| SMILES | CN(CCCCCS(=O)CCCC(F)(F)C(F)(F)F)CCCC1c2ccc(O)cc2OCC1(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H40F5NO4S/c1-28(22-9-11-23(37)12-10-22)21-40-27-20-24(38)13-14-25(27)26(28)8-6-17-36(2)16-4-3-5-18-41(39)19-7-15-29(31,32)30(33,34)35/h9-14,20,26,37-38H,3-8,15-19,21H2,1-2H3 |
| InChIKey | YOFMJCAEQQWMRK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|