C30H34F5NO5S — CID 58666060
(4R)-3-(4-hydroxyphenyl)-3-methyl-4-[2-[5-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-1,3-oxazol-2-yl]ethyl]-2,4-dihydrochromen-7-ol (PubChem CID 58666060) has the molecular formula C30H34F5NO5S and a molecular weight of 615.66 g/mol. Its IUPAC name is (4R)-3-(4-hydroxyphenyl)-3-methyl-4-[2-[5-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-1,3-oxazol-2-yl]ethyl]-2,4-dihydrochromen-7-ol.
| Compound Name | (4R)-3-(4-hydroxyphenyl)-3-methyl-4-[2-[5-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-1,3-oxazol-2-yl]ethyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 58666060 |
| Molecular Formula | C30H34F5NO5S |
| Molecular Weight | 615.66 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | (4R)-3-(4-hydroxyphenyl)-3-methyl-4-[2-[5-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-1,3-oxazol-2-yl]ethyl]-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2[C@@H]1CCc1ncc(CCCCS(=O)CCCC(F)(F)C(F)(F)F)o1 |
| InChI | InChI=1S/C30H34F5NO5S/c1-28(20-6-8-21(37)9-7-20)19-40-26-17-22(38)10-11-24(26)25(28)12-13-27-36-18-23(41-27)5-2-3-15-42(39)16-4-14-29(31,32)30(33,34)35/h6-11,17-18,25,37-38H,2-5,12-16,19H2,1H3/t25-,28?,42?/m0/s1 |
| InChIKey | MRESNWBGIXPXFC-XDUOHAAZSA-N |
| XLogP | 7.20 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|