C32H41F5O6 — CID 22033075
3-hydroxy-11-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid (PubChem CID 22033075) has the molecular formula C32H41F5O6 and a molecular weight of 616.66 g/mol. Its IUPAC name is 3-hydroxy-11-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid.
| Compound Name | 3-hydroxy-11-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
|---|---|
| PubChem CID | 22033075 |
| Molecular Formula | C32H41F5O6 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 3-hydroxy-11-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCC(O)C(CCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C32H41F5O6/c1-30(21-12-14-22(38)15-13-21)20-43-28-19-23(39)16-17-24(28)26(30)10-6-4-2-3-5-7-11-27(40)25(29(41)42)9-8-18-31(33,34)32(35,36)37/h12-17,19,25-27,38-40H,2-11,18,20H2,1H3,(H,41,42) |
| InChIKey | AYXIBDHTKKHKIO-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|