C32H43F5N4O4 — CID 152768709
1-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyliminomethyl]-3-(4,4,5,5,5-pentafluoropentylamino)urea (PubChem CID 152768709) has the molecular formula C32H43F5N4O4 and a molecular weight of 642.71 g/mol. Its IUPAC name is 1-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyliminomethyl]-3-(4,4,5,5,5-pentafluoropentylamino)urea.
| Compound Name | 1-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyliminomethyl]-3-(4,4,5,5,5-pentafluoropentylamino)urea |
|---|---|
| PubChem CID | 152768709 |
| Molecular Formula | C32H43F5N4O4 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 1-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyliminomethyl]-3-(4,4,5,5,5-pentafluoropentylamino)urea |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCC/N=C/NC(=O)NNCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H43F5N4O4/c1-30(23-11-13-24(42)14-12-23)21-45-28-20-25(43)15-16-26(28)27(30)10-7-5-3-2-4-6-8-18-38-22-39-29(44)41-40-19-9-17-31(33,34)32(35,36)37/h11-16,20,22,27,40,42-43H,2-10,17-19,21H2,1H3,(H2,38,39,41,44) |
| InChIKey | GXCKCBCAKHVSLT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|