C31H42F5NO5S — CID 22033233
4,4,5,5,5-pentafluoro-N-[10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]decyl]pentane-1-sulfonamide (PubChem CID 22033233) has the molecular formula C31H42F5NO5S and a molecular weight of 635.74 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-N-[10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]decyl]pentane-1-sulfonamide.
| Compound Name | 4,4,5,5,5-pentafluoro-N-[10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]decyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 22033233 |
| Molecular Formula | C31H42F5NO5S |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-N-[10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]decyl]pentane-1-sulfonamide |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCCCNS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H42F5NO5S/c1-29(23-12-14-24(38)15-13-23)22-42-28-21-25(39)16-17-26(28)27(29)11-8-6-4-2-3-5-7-9-19-37-43(40,41)20-10-18-30(32,33)31(34,35)36/h12-17,21,27,37-39H,2-11,18-20,22H2,1H3 |
| InChIKey | VHICDGSGLWDKLD-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|