C29H35F7O5S — CID 58666042
(4S)-4-[4-[2,2-difluoro-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butoxy]butyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol (PubChem CID 58666042) has the molecular formula C29H35F7O5S and a molecular weight of 628.65 g/mol. Its IUPAC name is (4S)-4-[4-[2,2-difluoro-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butoxy]butyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol.
| Compound Name | (4S)-4-[4-[2,2-difluoro-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butoxy]butyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 58666042 |
| Molecular Formula | C29H35F7O5S |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (4S)-4-[4-[2,2-difluoro-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butoxy]butyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2[C@H]1CCCCOCC(F)(F)CCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H35F7O5S/c1-26(20-6-8-21(37)9-7-20)18-41-25-17-22(38)10-11-23(25)24(26)5-2-3-14-40-19-27(30,31)13-16-42(39)15-4-12-28(32,33)29(34,35)36/h6-11,17,24,37-38H,2-5,12-16,18-19H2,1H3/t24-,26?,42?/m1/s1 |
| InChIKey | FWJPQTCXTCPCGP-HELJVMDASA-N |
| XLogP | 7.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|