C33H37F5O4S — CID 22033080
3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol (PubChem CID 22033080) has the molecular formula C33H37F5O4S and a molecular weight of 624.71 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033080 |
| Molecular Formula | C33H37F5O4S |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCOc1ccc(CCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H37F5O4S/c1-31(24-9-11-25(39)12-10-24)22-42-30-21-26(40)13-16-28(30)29(31)6-2-18-41-27-14-7-23(8-15-27)5-3-19-43-20-4-17-32(34,35)33(36,37)38/h7-16,21,29,39-40H,2-6,17-20,22H2,1H3 |
| InChIKey | ISAIULLJMCNNJZ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|