C40H47F5O10 — CID 22033265
2-[2-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid (PubChem CID 22033265) has the molecular formula C40H47F5O10 and a molecular weight of 782.80 g/mol. Its IUPAC name is 2-[2-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid.
| Compound Name | 2-[2-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid |
|---|---|
| PubChem CID | 22033265 |
| Molecular Formula | C40H47F5O10 |
| Molecular Weight | 782.80 g/mol |
| Exact Mass | 782.31 |
| IUPAC Name | 2-[2-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCc2ccc(OCCC(CCCC(F)(F)C(F)(F)F)(C(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C40H47F5O10/c1-37(28-11-15-30(16-12-28)54-25-50-2)24-53-34-23-31(55-26-51-3)17-18-32(34)33(37)8-5-4-7-27-9-13-29(14-10-27)52-22-21-38(35(46)47,36(48)49)19-6-20-39(41,42)40(43,44)45/h9-18,23,33H,4-8,19-22,24-26H2,1-3H3,(H,46,47)(H,48,49) |
| InChIKey | AHJKALPVPWPPGR-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.80 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|