C33H42O9S — CID 22033024
1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl methanesulfonate (PubChem CID 22033024) has the molecular formula C33H42O9S and a molecular weight of 614.76 g/mol. Its IUPAC name is 1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl methanesulfonate.
| Compound Name | 1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22033024 |
| Molecular Formula | C33H42O9S |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 1-[4-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]phenoxy]ethyl methanesulfonate |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCc2ccc(OC(C)OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C33H42O9S/c1-24(42-43(5,34)35)41-28-14-10-25(11-15-28)8-6-7-9-31-30-19-18-29(40-23-37-4)20-32(30)38-21-33(31,2)26-12-16-27(17-13-26)39-22-36-3/h10-20,24,31H,6-9,21-23H2,1-5H3 |
| InChIKey | APBDPJLRDCMDGG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|