C33H45F5O3S — CID 59109996
(3S,4S)-7-(methoxymethoxy)-3-methyl-3-(4-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene (PubChem CID 59109996) has the molecular formula C33H45F5O3S and a molecular weight of 616.78 g/mol. Its IUPAC name is (3S,4S)-7-(methoxymethoxy)-3-methyl-3-(4-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene.
| Compound Name | (3S,4S)-7-(methoxymethoxy)-3-methyl-3-(4-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene |
|---|---|
| PubChem CID | 59109996 |
| Molecular Formula | C33H45F5O3S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | (3S,4S)-7-(methoxymethoxy)-3-methyl-3-(4-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene |
| SMILES | COCOc1ccc2c(c1)OC[C@](C)(c1ccc(C)cc1)[C@@H]2CCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H45F5O3S/c1-25-13-15-26(16-14-25)31(2)23-40-30-22-27(41-24-39-3)17-18-28(30)29(31)12-9-7-5-4-6-8-10-20-42-21-11-19-32(34,35)33(36,37)38/h13-18,22,29H,4-12,19-21,23-24H2,1-3H3/t29-,31-/m1/s1 |
| InChIKey | VQKMJGPECCOTBM-BVRKHOPBSA-N |
| XLogP | 10.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|