C36H43F5O8S — CID 22033042
1-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]-3-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propan-2-ol (PubChem CID 22033042) has the molecular formula C36H43F5O8S and a molecular weight of 730.79 g/mol. Its IUPAC name is 1-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]-3-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propan-2-ol.
| Compound Name | 1-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]-3-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 22033042 |
| Molecular Formula | C36H43F5O8S |
| Molecular Weight | 730.79 g/mol |
| Exact Mass | 730.26 |
| IUPAC Name | 1-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]-3-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propan-2-ol |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2c2ccc(OCC(O)COCCSCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C36H43F5O8S/c1-34(26-7-11-29(12-8-26)48-23-43-2)22-47-32-19-30(49-24-44-3)13-14-31(32)33(34)25-5-9-28(10-6-25)46-21-27(42)20-45-16-18-50-17-4-15-35(37,38)36(39,40)41/h5-14,19,27,33,42H,4,15-18,20-24H2,1-3H3 |
| InChIKey | GVIVUAYWAFRBIZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.79 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|