C36H47F5O7 — CID 86592498
(2E)-11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylidene)undecanoic acid (PubChem CID 86592498) has the molecular formula C36H47F5O7 and a molecular weight of 686.75 g/mol. Its IUPAC name is (2E)-11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylidene)undecanoic acid.
| Compound Name | (2E)-11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylidene)undecanoic acid |
|---|---|
| PubChem CID | 86592498 |
| Molecular Formula | C36H47F5O7 |
| Molecular Weight | 686.75 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | (2E)-11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylidene)undecanoic acid |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCCCCCC/C(=C\CCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C36H47F5O7/c1-34(27-15-17-28(18-16-27)47-24-44-2)23-46-32-22-29(48-25-45-3)19-20-30(32)31(34)14-10-8-6-4-5-7-9-12-26(33(42)43)13-11-21-35(37,38)36(39,40)41/h13,15-20,22,31H,4-12,14,21,23-25H2,1-3H3,(H,42,43)/b26-13+ |
| InChIKey | QRNVVTCRWILOIA-LGJNPRDNSA-N |
| XLogP | 9.59 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.75 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|