C37H45F5O6S — CID 154450324
2,7-dimethoxy-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromene (PubChem CID 154450324) has the molecular formula C37H45F5O6S and a molecular weight of 712.82 g/mol. Its IUPAC name is 2,7-dimethoxy-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromene.
| Compound Name | 2,7-dimethoxy-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromene |
|---|---|
| PubChem CID | 154450324 |
| Molecular Formula | C37H45F5O6S |
| Molecular Weight | 712.82 g/mol |
| Exact Mass | 712.29 |
| IUPAC Name | 2,7-dimethoxy-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]phenoxy]propyl]-2,4-dihydrochromene |
| SMILES | COCOc1ccc(C2(C)C(OC)Oc3cc(OC)ccc3C2CCCOc2ccc(CCCSCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C37H45F5O6S/c1-35(27-12-16-29(17-13-27)47-25-43-2)32(31-19-18-30(44-3)24-33(31)48-34(35)45-4)9-5-21-46-28-14-10-26(11-15-28)8-6-22-49-23-7-20-36(38,39)37(40,41)42/h10-19,24,32,34H,5-9,20-23,25H2,1-4H3 |
| InChIKey | OXZOKTRKSSAYEK-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.82 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|