C38H51F5O7S — CID 87901765
diethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methylsulfanyl-2,4-dihydrochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate (PubChem CID 87901765) has the molecular formula C38H51F5O7S and a molecular weight of 746.88 g/mol. Its IUPAC name is diethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methylsulfanyl-2,4-dihydrochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate.
| Compound Name | diethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methylsulfanyl-2,4-dihydrochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
|---|---|
| PubChem CID | 87901765 |
| Molecular Formula | C38H51F5O7S |
| Molecular Weight | 746.88 g/mol |
| Exact Mass | 746.33 |
| IUPAC Name | diethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methylsulfanyl-2,4-dihydrochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
| SMILES | CCOC(=O)C(CCCCCCCCC1c2ccc(OC)cc2OCC1(SC)c1ccc(OC)cc1)(CCCC(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C38H51F5O7S/c1-6-48-33(44)35(34(45)49-7-2,23-14-24-37(39,40)38(41,42)43)22-13-11-9-8-10-12-15-31-30-21-20-29(47-4)25-32(30)50-26-36(31,51-5)27-16-18-28(46-3)19-17-27/h16-21,25,31H,6-15,22-24,26H2,1-5H3 |
| InChIKey | CIJCSVKUXYVRTG-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.88 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|