C29H38F5NO3S — CID 22033283
3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-3-pyridin-3-yl-2,4-dihydrochromen-7-ol (PubChem CID 22033283) has the molecular formula C29H38F5NO3S and a molecular weight of 575.68 g/mol. Its IUPAC name is 3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-3-pyridin-3-yl-2,4-dihydrochromen-7-ol.
| Compound Name | 3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-3-pyridin-3-yl-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033283 |
| Molecular Formula | C29H38F5NO3S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-3-pyridin-3-yl-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2cccnc2)COc2cc(O)ccc2C1CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H38F5NO3S/c1-27(22-11-9-16-35-20-22)21-38-26-19-23(36)13-14-24(26)25(27)12-7-5-3-2-4-6-8-17-39(37)18-10-15-28(30,31)29(32,33)34/h9,11,13-14,16,19-20,25,36H,2-8,10,12,15,17-18,21H2,1H3 |
| InChIKey | UEZKFZLSIQIDNT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|