C31H43ClF5N3O3 — CID 142638053
N'-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyl]-N-(4,4,5,5,5-pentafluoropentylamino)methanimidamide;hydrochloride (PubChem CID 142638053) has the molecular formula C31H43ClF5N3O3 and a molecular weight of 636.15 g/mol. Its IUPAC name is N'-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyl]-N-(4,4,5,5,5-pentafluoropentylamino)methanimidamide;hydrochloride.
| Compound Name | N'-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyl]-N-(4,4,5,5,5-pentafluoropentylamino)methanimidamide;hydrochloride |
|---|---|
| PubChem CID | 142638053 |
| Molecular Formula | C31H43ClF5N3O3 |
| Molecular Weight | 636.15 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | N'-[9-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]nonyl]-N-(4,4,5,5,5-pentafluoropentylamino)methanimidamide;hydrochloride |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCC/N=C/NNCCCC(F)(F)C(F)(F)F.Cl |
| InChI | InChI=1S/C31H42F5N3O3.ClH/c1-29(23-11-13-24(40)14-12-23)21-42-28-20-25(41)15-16-26(28)27(29)10-7-5-3-2-4-6-8-18-37-22-39-38-19-9-17-30(32,33)31(34,35)36;/h11-16,20,22,27,38,40-41H,2-10,17-19,21H2,1H3,(H,37,39);1H |
| InChIKey | STUCMLIPIZXLRS-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.15 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|