C33H48O5 — CID 59110006
11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-methyl-2-pentylundecanoic acid (PubChem CID 59110006) has the molecular formula C33H48O5 and a molecular weight of 524.74 g/mol. Its IUPAC name is 11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-methyl-2-pentylundecanoic acid.
| Compound Name | 11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-methyl-2-pentylundecanoic acid |
|---|---|
| PubChem CID | 59110006 |
| Molecular Formula | C33H48O5 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | 11-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-methyl-2-pentylundecanoic acid |
| SMILES | CCCCCC(C)(CCCCCCCCC[C@@H]1c2ccc(O)cc2OC[C@]1(C)c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C33H48O5/c1-4-5-12-21-32(2,31(36)37)22-13-10-8-6-7-9-11-14-29-28-20-19-27(35)23-30(28)38-24-33(29,3)25-15-17-26(34)18-16-25/h15-20,23,29,34-35H,4-14,21-22,24H2,1-3H3,(H,36,37)/t29-,32?,33-/m1/s1 |
| InChIKey | RGXVBRWYWPSUDS-MZHWSLLFSA-N |
| XLogP | 8.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|