C30H36F5NO5S — CID 87902083
3-(4-hydroxyphenyl)-3-methyl-4-[2-[2-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-4,5-dihydro-1,3-oxazol-4-yl]ethyl]-2,4-dihydrochromen-7-ol (PubChem CID 87902083) has the molecular formula C30H36F5NO5S and a molecular weight of 617.68 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[2-[2-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-4,5-dihydro-1,3-oxazol-4-yl]ethyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[2-[2-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-4,5-dihydro-1,3-oxazol-4-yl]ethyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 87902083 |
| Molecular Formula | C30H36F5NO5S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[2-[2-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]-4,5-dihydro-1,3-oxazol-4-yl]ethyl]-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCC1COC(CCCCS(=O)CCCC(F)(F)C(F)(F)F)=N1 |
| InChI | InChI=1S/C30H36F5NO5S/c1-28(20-6-9-22(37)10-7-20)19-41-26-17-23(38)11-12-24(26)25(28)13-8-21-18-40-27(36-21)5-2-3-15-42(39)16-4-14-29(31,32)30(33,34)35/h6-7,9-12,17,21,25,37-38H,2-5,8,13-16,18-19H2,1H3 |
| InChIKey | STAJWUHBTMEJJS-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|