C29H37F5O4S2 — CID 23537948
3-(4-hydroxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]propyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 23537948) has the molecular formula C29H37F5O4S2 and a molecular weight of 608.74 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]propyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]propyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 23537948 |
| Molecular Formula | C29H37F5O4S2 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]propyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1CCCOCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H37F5O4S2/c1-27(21-8-10-22(35)11-9-21)20-39-26-19-23(36)12-13-24(26)25(27)7-5-16-38-15-3-2-4-17-40(37)18-6-14-28(30,31)29(32,33)34/h8-13,19,25,35-36H,2-7,14-18,20H2,1H3 |
| InChIKey | KDTPGJCONWHNEA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|