C34H45F5O4S — CID 22033124
2-ethyl-10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid (PubChem CID 22033124) has the molecular formula C34H45F5O4S and a molecular weight of 644.79 g/mol. Its IUPAC name is 2-ethyl-10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid.
| Compound Name | 2-ethyl-10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid |
|---|---|
| PubChem CID | 22033124 |
| Molecular Formula | C34H45F5O4S |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 2-ethyl-10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid |
| SMILES | CCC(CCCCCCCCC1c2ccc(O)cc2SCC1(C)c1ccc(O)cc1)(CCCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C34H45F5O4S/c1-3-32(30(42)43,20-10-11-21-33(35,36)34(37,38)39)19-9-7-5-4-6-8-12-28-27-18-17-26(41)22-29(27)44-23-31(28,2)24-13-15-25(40)16-14-24/h13-18,22,28,40-41H,3-12,19-21,23H2,1-2H3,(H,42,43) |
| InChIKey | MAMVRTVCKDIKTK-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|