C19H24FN5O2 — CID 22046262
1-[4-fluoro-2-(1-piperidin-3-ylethoxy)phenyl]-3-(5-methylpyrazin-2-yl)urea (PubChem CID 22046262) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[4-fluoro-2-(1-piperidin-3-ylethoxy)phenyl]-3-(5-methylpyrazin-2-yl)urea.
| Compound Name | 1-[4-fluoro-2-(1-piperidin-3-ylethoxy)phenyl]-3-(5-methylpyrazin-2-yl)urea |
|---|---|
| PubChem CID | 22046262 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-[4-fluoro-2-(1-piperidin-3-ylethoxy)phenyl]-3-(5-methylpyrazin-2-yl)urea |
| SMILES | Cc1cnc(NC(=O)Nc2ccc(F)cc2OC(C)C2CCCNC2)cn1 |
| InChI | InChI=1S/C19H24FN5O2/c1-12-9-23-18(11-22-12)25-19(26)24-16-6-5-15(20)8-17(16)27-13(2)14-4-3-7-21-10-14/h5-6,8-9,11,13-14,21H,3-4,7,10H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | MFPMURZWUBZAMS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |