C15H18N2O4 — CID 22046725
2,3,4-trimethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 22046725) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,3,4-trimethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | 2,3,4-trimethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 22046725 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2,3,4-trimethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(c(OC)c1OC)N=CC1CCCN1C2=O |
| InChI | InChI=1S/C15H18N2O4/c1-19-11-7-10-12(14(21-3)13(11)20-2)16-8-9-5-4-6-17(9)15(10)18/h7-9H,4-6H2,1-3H3 |
| InChIKey | LOZISMUKOVKRIP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |