C22H30N4O4S — CID 22053776
4-methyl-2-(octylcarbamoylamino)-5-(pyridin-3-ylmethylcarbamoyl)thiophene-3-carboxylic acid (PubChem CID 22053776) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 4-methyl-2-(octylcarbamoylamino)-5-(pyridin-3-ylmethylcarbamoyl)thiophene-3-carboxylic acid.
| Compound Name | 4-methyl-2-(octylcarbamoylamino)-5-(pyridin-3-ylmethylcarbamoyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 22053776 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 4-methyl-2-(octylcarbamoylamino)-5-(pyridin-3-ylmethylcarbamoyl)thiophene-3-carboxylic acid |
| SMILES | CCCCCCCCNC(=O)Nc1sc(C(=O)NCc2cccnc2)c(C)c1C(=O)O |
| InChI | InChI=1S/C22H30N4O4S/c1-3-4-5-6-7-8-12-24-22(30)26-20-17(21(28)29)15(2)18(31-20)19(27)25-14-16-10-9-11-23-13-16/h9-11,13H,3-8,12,14H2,1-2H3,(H,25,27)(H,28,29)(H2,24,26,30) |
| InChIKey | NGRCLRSJDLMQKC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|